About 3-phenyltricyclo[3.3.1.03,7]nonane
3-phenyltricyclo[3.3.1.03,7]nonane (PubChem CID 14968757) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-phenyltricyclo[3.3.1.03,7]nonane.
Molecular Properties
| Compound Name | 3-phenyltricyclo[3.3.1.03,7]nonane |
| PubChem CID | 14968757 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-phenyltricyclo[3.3.1.03,7]nonane |
| SMILES | c1ccc(C23CC4CC(CC2C4)C3)cc1 |
| InChI | InChI=1S/C15H18/c1-2-4-13(5-3-1)15-9-11-6-12(10-15)8-14(15)7-11/h1-5,11-12,14H,6-10H2 |
| InChIKey | WQJRUZFEUXAHGE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-phenyltricyclo[3.3.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyltricyclo[3.3.1.03,7]nonane?
The IUPAC name of 3-phenyltricyclo[3.3.1.03,7]nonane (CID 14968757) is 3-phenyltricyclo[3.3.1.03,7]nonane.
What is the SMILES notation for 3-phenyltricyclo[3.3.1.03,7]nonane?
The canonical SMILES for 3-phenyltricyclo[3.3.1.03,7]nonane is c1ccc(C23CC4CC(CC2C4)C3)cc1.
What is the InChIKey of 3-phenyltricyclo[3.3.1.03,7]nonane?
The InChIKey is WQJRUZFEUXAHGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18/c1-2-4-13(5-3-1)15-9-11-6-12(10-15)8-14(15)7-11/h1-5,11-12,14H,6-10H2.
What are the key properties of 3-phenyltricyclo[3.3.1.03,7]nonane?
3-phenyltricyclo[3.3.1.03,7]nonane has a molecular weight of 198.31 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyltricyclo[3.3.1.03,7]nonane is sourced from PubChem (CID 14968757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).