About 1-prop-2-enyl-3,7-dihydropurine-2,6-dione
1-prop-2-enyl-3,7-dihydropurine-2,6-dione (PubChem CID 14969716) has the molecular formula C8H8N4O2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 1-prop-2-enyl-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 1-prop-2-enyl-3,7-dihydropurine-2,6-dione |
| PubChem CID | 14969716 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 1-prop-2-enyl-3,7-dihydropurine-2,6-dione |
| SMILES | C=CCn1c(=O)[nH]c2nc[nH]c2c1=O |
| InChI | InChI=1S/C8H8N4O2/c1-2-3-12-7(13)5-6(10-4-9-5)11-8(12)14/h2,4H,1,3H2,(H,9,10)(H,11,14) |
| InChIKey | IPKIKTHDWDXHPU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-3,7-dihydropurine-2,6-dione?
The IUPAC name of 1-prop-2-enyl-3,7-dihydropurine-2,6-dione (CID 14969716) is 1-prop-2-enyl-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 1-prop-2-enyl-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 1-prop-2-enyl-3,7-dihydropurine-2,6-dione is C=CCn1c(=O)[nH]c2nc[nH]c2c1=O.
What is the InChIKey of 1-prop-2-enyl-3,7-dihydropurine-2,6-dione?
The InChIKey is IPKIKTHDWDXHPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c1-2-3-12-7(13)5-6(10-4-9-5)11-8(12)14/h2,4H,1,3H2,(H,9,10)(H,11,14).
What are the key properties of 1-prop-2-enyl-3,7-dihydropurine-2,6-dione?
1-prop-2-enyl-3,7-dihydropurine-2,6-dione has a molecular weight of 192.18 g/mol, XLogP of -0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 14969716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).