About trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane
trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane (PubChem CID 14970163) has the molecular formula C16H32OSn
and a molecular weight of 359.14 g/mol. Its IUPAC name is trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane.
Molecular Properties
| Compound Name | trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane |
| PubChem CID | 14970163 |
| Molecular Formula | C16H32OSn |
| Molecular Weight | 359.14 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane |
| SMILES | C/C=C(\O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C13H23O.3CH3.Sn/c1-5-8-14-13-9-11(4)6-7-12(13)10(2)3;;;;/h5,10-13H,6-7,9H2,1-4H3;3*1H3;/t11-,12+,13-;;;;/m1..../s1 |
| InChIKey | CWKDXTVSNBLKAF-GZCRQEFQSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.14 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane?
The IUPAC name of trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane (CID 14970163) is trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane.
What is the SMILES notation for trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane?
The canonical SMILES for trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane is C/C=C(\O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)[Sn](C)(C)C.
What is the InChIKey of trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane?
The InChIKey is CWKDXTVSNBLKAF-GZCRQEFQSA-N. The full InChI is InChI=1S/C13H23O.3CH3.Sn/c1-5-8-14-13-9-11(4)6-7-12(13)10(2)3;;;;/h5,10-13H,6-7,9H2,1-4H3;3*1H3;/t11-,12+,13-;;;;/m1..../s1.
What are the key properties of trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane?
trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane has a molecular weight of 359.14 g/mol, XLogP of 5.24, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(E)-1-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyprop-1-enyl]stannane is sourced from PubChem (CID 14970163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).