C13H15NO6 — CID 14970401
7-O-ethyl 2-O,3-O-dimethyl (1S,4R)-7-azabicyclo[2.2.1]hepta-2,5-diene-2,3,7-tricarboxylate (PubChem CID 14970401) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 7-O-ethyl 2-O,3-O-dimethyl (1S,4R)-7-azabicyclo[2.2.1]hepta-2,5-diene-2,3,7-tricarboxylate.
| Compound Name | 7-O-ethyl 2-O,3-O-dimethyl (1S,4R)-7-azabicyclo[2.2.1]hepta-2,5-diene-2,3,7-tricarboxylate |
|---|---|
| PubChem CID | 14970401 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 7-O-ethyl 2-O,3-O-dimethyl (1S,4R)-7-azabicyclo[2.2.1]hepta-2,5-diene-2,3,7-tricarboxylate |
| SMILES | CCOC(=O)N1[C@@H]2C=C[C@H]1C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C13H15NO6/c1-4-20-13(17)14-7-5-6-8(14)10(12(16)19-3)9(7)11(15)18-2/h5-8H,4H2,1-3H3/t7-,8+ |
| InChIKey | BKKCJECURBSTQU-OCAPTIKFSA-N |
| XLogP | 0.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|