About 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one
5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one (PubChem CID 14970448) has the molecular formula C18H32N2O2
and a molecular weight of 308.47 g/mol. Its IUPAC name is 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one.
Molecular Properties
| Compound Name | 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one |
| PubChem CID | 14970448 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one |
| SMILES | CC(=CC(=O)C(C)(C)C)NCCNC(C)=CC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H32N2O2/c1-13(11-15(21)17(3,4)5)19-9-10-20-14(2)12-16(22)18(6,7)8/h11-12,19-20H,9-10H2,1-8H3 |
| InChIKey | UNXPBEGHGQEGCJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one?
The IUPAC name of 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one (CID 14970448) is 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one.
What is the SMILES notation for 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one?
The canonical SMILES for 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one is CC(=CC(=O)C(C)(C)C)NCCNC(C)=CC(=O)C(C)(C)C.
What is the InChIKey of 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one?
The InChIKey is UNXPBEGHGQEGCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O2/c1-13(11-15(21)17(3,4)5)19-9-10-20-14(2)12-16(22)18(6,7)8/h11-12,19-20H,9-10H2,1-8H3.
What are the key properties of 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one?
5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one has a molecular weight of 308.47 g/mol, XLogP of 3.20, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[(5,5-dimethyl-4-oxohex-2-en-2-yl)amino]ethylamino]-2,2-dimethylhex-4-en-3-one is sourced from PubChem (CID 14970448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).