C19H15N5O5 — CID 14970911
(2Z)-6-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)naphthalene-2-carboximidate (PubChem CID 14970911) has the molecular formula C19H15N5O5 and a molecular weight of 393.36 g/mol. Its IUPAC name is (2Z)-6-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)naphthalene-2-carboximidate.
| Compound Name | (2Z)-6-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)naphthalene-2-carboximidate |
|---|---|
| PubChem CID | 14970911 |
| Molecular Formula | C19H15N5O5 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (2Z)-6-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-N-(1-methyl-1,2,4-triazol-4-ium-4-yl)naphthalene-2-carboximidate |
| SMILES | Cn1c[n+](/N=C(\[O-])c2ccc3cc(C(=O)ON4C(=O)CCC4=O)ccc3c2)cn1 |
| InChI | InChI=1S/C19H15N5O5/c1-22-11-23(10-20-22)21-18(27)14-4-2-13-9-15(5-3-12(13)8-14)19(28)29-24-16(25)6-7-17(24)26/h2-5,8-11H,6-7H2,1H3 |
| InChIKey | WLVRDGWAWSWDJE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 120.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|