C21H20N4O6S — CID 1497119
ethyl 5-[[5-(2-methoxy-2-oxoethylidene)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]-3-(2-oxopropyl)imidazole-4-carboxylate (PubChem CID 1497119) has the molecular formula C21H20N4O6S and a molecular weight of 456.48 g/mol. Its IUPAC name is ethyl 5-[[5-(2-methoxy-2-oxoethylidene)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]-3-(2-oxopropyl)imidazole-4-carboxylate.
| Compound Name | ethyl 5-[[5-(2-methoxy-2-oxoethylidene)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]-3-(2-oxopropyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 1497119 |
| Molecular Formula | C21H20N4O6S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | ethyl 5-[[5-(2-methoxy-2-oxoethylidene)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino]-3-(2-oxopropyl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(N=C2SC(=CC(=O)OC)C(=O)N2c2ccccc2)ncn1CC(C)=O |
| InChI | InChI=1S/C21H20N4O6S/c1-4-31-20(29)17-18(22-12-24(17)11-13(2)26)23-21-25(14-8-6-5-7-9-14)19(28)15(32-21)10-16(27)30-3/h5-10,12H,4,11H2,1-3H3 |
| InChIKey | VLSJHGGRZFKVGP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 120.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|