About 5-nitro-4,5-dihydro-1,2-oxazole
5-nitro-4,5-dihydro-1,2-oxazole (PubChem CID 14971736) has the molecular formula C3H4N2O3
and a molecular weight of 116.08 g/mol. Its IUPAC name is 5-nitro-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-nitro-4,5-dihydro-1,2-oxazole |
| PubChem CID | 14971736 |
| Molecular Formula | C3H4N2O3 |
| Molecular Weight | 116.08 g/mol |
| Exact Mass | 116.02 |
| IUPAC Name | 5-nitro-4,5-dihydro-1,2-oxazole |
| SMILES | O=[N+]([O-])C1CC=NO1 |
| InChI | InChI=1S/C3H4N2O3/c6-5(7)3-1-2-4-8-3/h2-3H,1H2 |
| InChIKey | QYLHVVUQGDWOIW-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.08 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-nitro-4,5-dihydro-1,2-oxazole (CID 14971736) is 5-nitro-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-nitro-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-nitro-4,5-dihydro-1,2-oxazole is O=[N+]([O-])C1CC=NO1.
What is the InChIKey of 5-nitro-4,5-dihydro-1,2-oxazole?
The InChIKey is QYLHVVUQGDWOIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O3/c6-5(7)3-1-2-4-8-3/h2-3H,1H2.
What are the key properties of 5-nitro-4,5-dihydro-1,2-oxazole?
5-nitro-4,5-dihydro-1,2-oxazole has a molecular weight of 116.08 g/mol, XLogP of -0.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 14971736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).