About 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid
2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid (PubChem CID 14971768) has the molecular formula C26H23NO4S
and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid |
| PubChem CID | 14971768 |
| Molecular Formula | C26H23NO4S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid |
| SMILES | CSC(Cc1cccc(OCC(=O)O)c1)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C26H23NO4S/c1-32-22(16-18-9-8-14-21(15-18)30-17-23(28)29)26-27-24(19-10-4-2-5-11-19)25(31-26)20-12-6-3-7-13-20/h2-15,22H,16-17H2,1H3,(H,28,29) |
| InChIKey | KPYUAGMNCDNPKC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid?
The IUPAC name of 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid (CID 14971768) is 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid.
What is the SMILES notation for 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid?
The canonical SMILES for 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid is CSC(Cc1cccc(OCC(=O)O)c1)c1nc(-c2ccccc2)c(-c2ccccc2)o1.
What is the InChIKey of 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid?
The InChIKey is KPYUAGMNCDNPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23NO4S/c1-32-22(16-18-9-8-14-21(15-18)30-17-23(28)29)26-27-24(19-10-4-2-5-11-19)25(31-26)20-12-6-3-7-13-20/h2-15,22H,16-17H2,1H3,(H,28,29).
What are the key properties of 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid?
2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid has a molecular weight of 445.54 g/mol, XLogP of 6.12, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-2-methylsulfanylethyl]phenoxy]acetic acid is sourced from PubChem (CID 14971768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).