C28H27NO4 — CID 14971771
2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-3-methylbutyl]phenoxy]acetic acid (PubChem CID 14971771) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-3-methylbutyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-3-methylbutyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 14971771 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[3-[2-(4,5-diphenyl-1,3-oxazol-2-yl)-3-methylbutyl]phenoxy]acetic acid |
| SMILES | CC(C)C(Cc1cccc(OCC(=O)O)c1)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C28H27NO4/c1-19(2)24(17-20-10-9-15-23(16-20)32-18-25(30)31)28-29-26(21-11-5-3-6-12-21)27(33-28)22-13-7-4-8-14-22/h3-16,19,24H,17-18H2,1-2H3,(H,30,31) |
| InChIKey | GGKWSWAGDRQJLA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |