About methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate
methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate (PubChem CID 14971800) has the molecular formula C27H20N2O4
and a molecular weight of 436.47 g/mol. Its IUPAC name is methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate |
| PubChem CID | 14971800 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(/C=C(\C#N)c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C27H20N2O4/c1-31-24(30)18-32-23-14-8-9-19(16-23)15-22(17-28)27-29-25(20-10-4-2-5-11-20)26(33-27)21-12-6-3-7-13-21/h2-16H,18H2,1H3/b22-15+ |
| InChIKey | ZDJRDJHWUSFREX-PXLXIMEGSA-N |
| XLogP | 5.62 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate?
The IUPAC name of methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate (CID 14971800) is methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate.
What is the SMILES notation for methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate?
The canonical SMILES for methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate is COC(=O)COc1cccc(/C=C(\C#N)c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1.
What is the InChIKey of methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate?
The InChIKey is ZDJRDJHWUSFREX-PXLXIMEGSA-N. The full InChI is InChI=1S/C27H20N2O4/c1-31-24(30)18-32-23-14-8-9-19(16-23)15-22(17-28)27-29-25(20-10-4-2-5-11-20)26(33-27)21-12-6-3-7-13-21/h2-16H,18H2,1H3/b22-15+.
What are the key properties of methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate?
methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate has a molecular weight of 436.47 g/mol, XLogP of 5.62, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-[(E)-2-cyano-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetate is sourced from PubChem (CID 14971800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).