About 3-iodo-1-phenylpyrazole
3-iodo-1-phenylpyrazole (PubChem CID 14972074) has the molecular formula C9H7IN2
and a molecular weight of 270.07 g/mol. Its IUPAC name is 3-iodo-1-phenylpyrazole.
Molecular Properties
| Compound Name | 3-iodo-1-phenylpyrazole |
| PubChem CID | 14972074 |
| Molecular Formula | C9H7IN2 |
| Molecular Weight | 270.07 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 3-iodo-1-phenylpyrazole |
| SMILES | Ic1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H7IN2/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h1-7H |
| InChIKey | RJCCRXXUBFGPBW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.07 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-1-phenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-1-phenylpyrazole?
The IUPAC name of 3-iodo-1-phenylpyrazole (CID 14972074) is 3-iodo-1-phenylpyrazole.
What is the SMILES notation for 3-iodo-1-phenylpyrazole?
The canonical SMILES for 3-iodo-1-phenylpyrazole is Ic1ccn(-c2ccccc2)n1.
What is the InChIKey of 3-iodo-1-phenylpyrazole?
The InChIKey is RJCCRXXUBFGPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7IN2/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h1-7H.
What are the key properties of 3-iodo-1-phenylpyrazole?
3-iodo-1-phenylpyrazole has a molecular weight of 270.07 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1-phenylpyrazole is sourced from PubChem (CID 14972074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).