C17H18O3 — CID 14972315
(4S,5S)-2-methoxy-2-methyl-4,5-diphenyl-1,3-dioxolane (PubChem CID 14972315) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (4S,5S)-2-methoxy-2-methyl-4,5-diphenyl-1,3-dioxolane.
| Compound Name | (4S,5S)-2-methoxy-2-methyl-4,5-diphenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 14972315 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (4S,5S)-2-methoxy-2-methyl-4,5-diphenyl-1,3-dioxolane |
| SMILES | COC1(C)O[C@@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C17H18O3/c1-17(18-2)19-15(13-9-5-3-6-10-13)16(20-17)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | IBSIFLQLQSKVLD-HOTGVXAUSA-N |
| XLogP | 3.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |