C13H19NO — CID 14972595
N,2-di(propan-2-yl)benzamide (PubChem CID 14972595) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N,2-di(propan-2-yl)benzamide.
| Compound Name | N,2-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 14972595 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N,2-di(propan-2-yl)benzamide |
| SMILES | CC(C)NC(=O)c1ccccc1C(C)C |
| InChI | InChI=1S/C13H19NO/c1-9(2)11-7-5-6-8-12(11)13(15)14-10(3)4/h5-10H,1-4H3,(H,14,15) |
| InChIKey | OHNKGNWQGAVTQG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |