About 2-bromo-4-methylpenta-1,3-diene
2-bromo-4-methylpenta-1,3-diene (PubChem CID 14972765) has the molecular formula C6H9Br
and a molecular weight of 161.04 g/mol. Its IUPAC name is 2-bromo-4-methylpenta-1,3-diene.
Molecular Properties
| Compound Name | 2-bromo-4-methylpenta-1,3-diene |
| PubChem CID | 14972765 |
| Molecular Formula | C6H9Br |
| Molecular Weight | 161.04 g/mol |
| Exact Mass | 159.99 |
| IUPAC Name | 2-bromo-4-methylpenta-1,3-diene |
| SMILES | C=C(Br)C=C(C)C |
| InChI | InChI=1S/C6H9Br/c1-5(2)4-6(3)7/h4H,3H2,1-2H3 |
| InChIKey | SFFZWNLXKVSTGB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.04 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-methylpenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methylpenta-1,3-diene?
The IUPAC name of 2-bromo-4-methylpenta-1,3-diene (CID 14972765) is 2-bromo-4-methylpenta-1,3-diene.
What is the SMILES notation for 2-bromo-4-methylpenta-1,3-diene?
The canonical SMILES for 2-bromo-4-methylpenta-1,3-diene is C=C(Br)C=C(C)C.
What is the InChIKey of 2-bromo-4-methylpenta-1,3-diene?
The InChIKey is SFFZWNLXKVSTGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Br/c1-5(2)4-6(3)7/h4H,3H2,1-2H3.
What are the key properties of 2-bromo-4-methylpenta-1,3-diene?
2-bromo-4-methylpenta-1,3-diene has a molecular weight of 161.04 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methylpenta-1,3-diene is sourced from PubChem (CID 14972765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).