About 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide
2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide (PubChem CID 14973192) has the molecular formula C23H36N2O
and a molecular weight of 356.55 g/mol. Its IUPAC name is 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide |
| PubChem CID | 14973192 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide |
| SMILES | CC1CCCC(C)N1CCCNC(=O)C(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C23H36N2O/c1-18-10-8-11-19(2)25(18)17-9-16-24-23(26)22(21-14-6-7-15-21)20-12-4-3-5-13-20/h3-5,12-13,18-19,21-22H,6-11,14-17H2,1-2H3,(H,24,26) |
| InChIKey | UXGYHPCEXONQIZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide?
The IUPAC name of 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide (CID 14973192) is 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide.
What is the SMILES notation for 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide?
The canonical SMILES for 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide is CC1CCCC(C)N1CCCNC(=O)C(c1ccccc1)C1CCCC1.
What is the InChIKey of 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide?
The InChIKey is UXGYHPCEXONQIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36N2O/c1-18-10-8-11-19(2)25(18)17-9-16-24-23(26)22(21-14-6-7-15-21)20-12-4-3-5-13-20/h3-5,12-13,18-19,21-22H,6-11,14-17H2,1-2H3,(H,24,26).
What are the key properties of 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide?
2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide has a molecular weight of 356.55 g/mol, XLogP of 4.73, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-phenylacetamide is sourced from PubChem (CID 14973192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).