About [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate
[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate (PubChem CID 14973211) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate.
Molecular Properties
| Compound Name | [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate |
| PubChem CID | 14973211 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2[nH]cc(C3=CCN(C)CC3)c2c1 |
| InChI | InChI=1S/C16H18N2O2/c1-11(19)20-13-3-4-16-14(9-13)15(10-17-16)12-5-7-18(2)8-6-12/h3-5,9-10,17H,6-8H2,1-2H3 |
| InChIKey | VUSHUJJMAWIKFI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate?
The IUPAC name of [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate (CID 14973211) is [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate.
What is the SMILES notation for [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate?
The canonical SMILES for [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate is CC(=O)Oc1ccc2[nH]cc(C3=CCN(C)CC3)c2c1.
What is the InChIKey of [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate?
The InChIKey is VUSHUJJMAWIKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-11(19)20-13-3-4-16-14(9-13)15(10-17-16)12-5-7-18(2)8-6-12/h3-5,9-10,17H,6-8H2,1-2H3.
What are the key properties of [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate?
[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate has a molecular weight of 270.33 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl] acetate is sourced from PubChem (CID 14973211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).