C21H29NO2S — CID 14974371
(2S,3S,6S,8aR)-6-[(2R)-but-3-en-2-yl]-3-(methoxymethyl)-6,8a-dimethyl-2-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-5-thione (PubChem CID 14974371) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is (2S,3S,6S,8aR)-6-[(2R)-but-3-en-2-yl]-3-(methoxymethyl)-6,8a-dimethyl-2-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-5-thione.
| Compound Name | (2S,3S,6S,8aR)-6-[(2R)-but-3-en-2-yl]-3-(methoxymethyl)-6,8a-dimethyl-2-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-5-thione |
|---|---|
| PubChem CID | 14974371 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (2S,3S,6S,8aR)-6-[(2R)-but-3-en-2-yl]-3-(methoxymethyl)-6,8a-dimethyl-2-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-5-thione |
| SMILES | C=C[C@@H](C)[C@]1(C)CC[C@@]2(C)O[C@@H](c3ccccc3)[C@H](COC)N2C1=S |
| InChI | InChI=1S/C21H29NO2S/c1-6-15(2)20(3)12-13-21(4)22(19(20)25)17(14-23-5)18(24-21)16-10-8-7-9-11-16/h6-11,15,17-18H,1,12-14H2,2-5H3/t15-,17+,18+,20+,21-/m1/s1 |
| InChIKey | TYVFUWVLWFLIMH-NRJJLHBYSA-N |
| XLogP | 4.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|