C13H18O3 — CID 14974598
(8'aS)-8'a-methylspiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-one (PubChem CID 14974598) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (8'aS)-8'a-methylspiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-one.
| Compound Name | (8'aS)-8'a-methylspiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 14974598 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (8'aS)-8'a-methylspiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-one |
| SMILES | C[C@]12CCC3(C=C1CCCC2=O)OCCO3 |
| InChI | InChI=1S/C13H18O3/c1-12-5-6-13(15-7-8-16-13)9-10(12)3-2-4-11(12)14/h9H,2-8H2,1H3/t12-/m0/s1 |
| InChIKey | LHTZWWKBELJKOO-LBPRGKRZSA-N |
| XLogP | 2.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|