About cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone
cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone (PubChem CID 14974779) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone.
Analyze cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone?
The IUPAC name of cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone (CID 14974779) is cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone.
What is the SMILES notation for cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone?
The canonical SMILES for cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone is O=C(C1=CCCC1)C1=COCCC1.
What is the InChIKey of cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone?
The InChIKey is OXIVDGBBSHWCEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c12-11(9-4-1-2-5-9)10-6-3-7-13-8-10/h4,8H,1-3,5-7H2.
What are the key properties of cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone?
cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone has a molecular weight of 178.23 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl(3,4-dihydro-2H-pyran-5-yl)methanone is sourced from PubChem (CID 14974779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).