About 2-bromo-4,6-dimethylpyridine
2-bromo-4,6-dimethylpyridine (PubChem CID 14975195) has the molecular formula C7H8BrN
and a molecular weight of 186.05 g/mol. Its IUPAC name is 2-bromo-4,6-dimethylpyridine.
Molecular Properties
| Compound Name | 2-bromo-4,6-dimethylpyridine |
| PubChem CID | 14975195 |
| Molecular Formula | C7H8BrN |
| Molecular Weight | 186.05 g/mol |
| Exact Mass | 184.98 |
| IUPAC Name | 2-bromo-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)nc(Br)c1 |
| InChI | InChI=1S/C7H8BrN/c1-5-3-6(2)9-7(8)4-5/h3-4H,1-2H3 |
| InChIKey | IRTOCXBLUOPRFT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.05 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,6-dimethylpyridine?
The IUPAC name of 2-bromo-4,6-dimethylpyridine (CID 14975195) is 2-bromo-4,6-dimethylpyridine.
What is the SMILES notation for 2-bromo-4,6-dimethylpyridine?
The canonical SMILES for 2-bromo-4,6-dimethylpyridine is Cc1cc(C)nc(Br)c1.
What is the InChIKey of 2-bromo-4,6-dimethylpyridine?
The InChIKey is IRTOCXBLUOPRFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN/c1-5-3-6(2)9-7(8)4-5/h3-4H,1-2H3.
What are the key properties of 2-bromo-4,6-dimethylpyridine?
2-bromo-4,6-dimethylpyridine has a molecular weight of 186.05 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,6-dimethylpyridine is sourced from PubChem (CID 14975195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).