About N'-ethoxy-N'-methylethane-1,2-diamine
N'-ethoxy-N'-methylethane-1,2-diamine (PubChem CID 14975842) has the molecular formula C5H14N2O
and a molecular weight of 118.18 g/mol. Its IUPAC name is N'-ethoxy-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethoxy-N'-methylethane-1,2-diamine |
| PubChem CID | 14975842 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | N'-ethoxy-N'-methylethane-1,2-diamine |
| SMILES | CCON(C)CCN |
| InChI | InChI=1S/C5H14N2O/c1-3-8-7(2)5-4-6/h3-6H2,1-2H3 |
| InChIKey | YUOUOXQDKOCEIV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethoxy-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethoxy-N'-methylethane-1,2-diamine?
The IUPAC name of N'-ethoxy-N'-methylethane-1,2-diamine (CID 14975842) is N'-ethoxy-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-ethoxy-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-ethoxy-N'-methylethane-1,2-diamine is CCON(C)CCN.
What is the InChIKey of N'-ethoxy-N'-methylethane-1,2-diamine?
The InChIKey is YUOUOXQDKOCEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2O/c1-3-8-7(2)5-4-6/h3-6H2,1-2H3.
What are the key properties of N'-ethoxy-N'-methylethane-1,2-diamine?
N'-ethoxy-N'-methylethane-1,2-diamine has a molecular weight of 118.18 g/mol, XLogP of -0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethoxy-N'-methylethane-1,2-diamine is sourced from PubChem (CID 14975842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).