C18H15NS — CID 14976073
6-phenyl-6,11-dihydropyrrolo[2,1-c][1,4]benzothiazepine (PubChem CID 14976073) has the molecular formula C18H15NS and a molecular weight of 277.39 g/mol. Its IUPAC name is 6-phenyl-6,11-dihydropyrrolo[2,1-c][1,4]benzothiazepine.
| Compound Name | 6-phenyl-6,11-dihydropyrrolo[2,1-c][1,4]benzothiazepine |
|---|---|
| PubChem CID | 14976073 |
| Molecular Formula | C18H15NS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 6-phenyl-6,11-dihydropyrrolo[2,1-c][1,4]benzothiazepine |
| SMILES | c1ccc(C2Sc3ccccc3Cn3cccc32)cc1 |
| InChI | InChI=1S/C18H15NS/c1-2-7-14(8-3-1)18-16-10-6-12-19(16)13-15-9-4-5-11-17(15)20-18/h1-12,18H,13H2 |
| InChIKey | GMKUFNCUVBJTFE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |