About dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane
dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane (PubChem CID 14976242) has the molecular formula C12H22Cl2Si
and a molecular weight of 265.30 g/mol. Its IUPAC name is dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane.
Molecular Properties
| Compound Name | dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane |
| PubChem CID | 14976242 |
| Molecular Formula | C12H22Cl2Si |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane |
| SMILES | C=C(C)C(=C)C[Si](Cl)(Cl)CCC(C)(C)C |
| InChI | InChI=1S/C12H22Cl2Si/c1-10(2)11(3)9-15(13,14)8-7-12(4,5)6/h1,3,7-9H2,2,4-6H3 |
| InChIKey | PKQPGRIGSPRTFO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane?
The IUPAC name of dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane (CID 14976242) is dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane.
What is the SMILES notation for dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane?
The canonical SMILES for dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane is C=C(C)C(=C)C[Si](Cl)(Cl)CCC(C)(C)C.
What is the InChIKey of dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane?
The InChIKey is PKQPGRIGSPRTFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22Cl2Si/c1-10(2)11(3)9-15(13,14)8-7-12(4,5)6/h1,3,7-9H2,2,4-6H3.
What are the key properties of dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane?
dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane has a molecular weight of 265.30 g/mol, XLogP of 5.47, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-(3,3-dimethylbutyl)-(3-methyl-2-methylidenebut-3-enyl)silane is sourced from PubChem (CID 14976242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).