About (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one
(5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one (PubChem CID 14976460) has the molecular formula C10H6F6O4
and a molecular weight of 304.14 g/mol. Its IUPAC name is (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one.
Molecular Properties
| Compound Name | (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one |
| PubChem CID | 14976460 |
| Molecular Formula | C10H6F6O4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one |
| SMILES | O=C1C=C[C@@]([C@H]2CC(=O)O[C@@H]2C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C10H6F6O4/c11-9(12,13)7-4(3-6(18)19-7)8(10(14,15)16)2-1-5(17)20-8/h1-2,4,7H,3H2/t4-,7-,8+/m0/s1 |
| InChIKey | NZUVPQCNIDRACZ-ZQASAOEGSA-N |
| XLogP | 1.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one?
The IUPAC name of (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one (CID 14976460) is (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one.
What is the SMILES notation for (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one?
The canonical SMILES for (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one is O=C1C=C[C@@]([C@H]2CC(=O)O[C@@H]2C(F)(F)F)(C(F)(F)F)O1.
What is the InChIKey of (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one?
The InChIKey is NZUVPQCNIDRACZ-ZQASAOEGSA-N. The full InChI is InChI=1S/C10H6F6O4/c11-9(12,13)7-4(3-6(18)19-7)8(10(14,15)16)2-1-5(17)20-8/h1-2,4,7H,3H2/t4-,7-,8+/m0/s1.
What are the key properties of (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one?
(5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one has a molecular weight of 304.14 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(2S,3S)-5-oxo-2-(trifluoromethyl)oxolan-3-yl]-5-(trifluoromethyl)furan-2-one is sourced from PubChem (CID 14976460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).