C42H40O12S2 — CID 14976874
(2S,3S)-2,3-dibenzoyloxy-4-[(E)-8,8-bis(benzenesulfonyl)-4-methylundec-4-en-10-ynoxy]-4-oxobutanoic acid (PubChem CID 14976874) has the molecular formula C42H40O12S2 and a molecular weight of 800.90 g/mol. Its IUPAC name is (2S,3S)-2,3-dibenzoyloxy-4-[(E)-8,8-bis(benzenesulfonyl)-4-methylundec-4-en-10-ynoxy]-4-oxobutanoic acid.
| Compound Name | (2S,3S)-2,3-dibenzoyloxy-4-[(E)-8,8-bis(benzenesulfonyl)-4-methylundec-4-en-10-ynoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14976874 |
| Molecular Formula | C42H40O12S2 |
| Molecular Weight | 800.90 g/mol |
| Exact Mass | 800.20 |
| IUPAC Name | (2S,3S)-2,3-dibenzoyloxy-4-[(E)-8,8-bis(benzenesulfonyl)-4-methylundec-4-en-10-ynoxy]-4-oxobutanoic acid |
| SMILES | C#CCC(CC/C=C(\C)CCCOC(=O)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)C(=O)O)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C42H40O12S2/c1-3-28-42(55(48,49)34-24-12-6-13-25-34,56(50,51)35-26-14-7-15-27-35)29-16-18-31(2)19-17-30-52-41(47)37(54-40(46)33-22-10-5-11-23-33)36(38(43)44)53-39(45)32-20-8-4-9-21-32/h1,4-15,18,20-27,36-37H,16-17,19,28-30H2,2H3,(H,43,44)/b31-18+/t36-,37-/m0/s1 |
| InChIKey | YMDMCZYSFOPVMH-JKHFGXDPSA-N |
| XLogP | 6.24 |
| TPSA | 184.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.90 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|