About 4-pyridin-4-yl-1,3,5-triazin-2-amine
4-pyridin-4-yl-1,3,5-triazin-2-amine (PubChem CID 14977275) has the molecular formula C8H7N5
and a molecular weight of 173.18 g/mol. Its IUPAC name is 4-pyridin-4-yl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-pyridin-4-yl-1,3,5-triazin-2-amine |
| PubChem CID | 14977275 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 4-pyridin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1ncnc(-c2ccncc2)n1 |
| InChI | InChI=1S/C8H7N5/c9-8-12-5-11-7(13-8)6-1-3-10-4-2-6/h1-5H,(H2,9,11,12,13) |
| InChIKey | XDOWEJICGSZQCA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-pyridin-4-yl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-yl-1,3,5-triazin-2-amine?
The IUPAC name of 4-pyridin-4-yl-1,3,5-triazin-2-amine (CID 14977275) is 4-pyridin-4-yl-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-pyridin-4-yl-1,3,5-triazin-2-amine?
The canonical SMILES for 4-pyridin-4-yl-1,3,5-triazin-2-amine is Nc1ncnc(-c2ccncc2)n1.
What is the InChIKey of 4-pyridin-4-yl-1,3,5-triazin-2-amine?
The InChIKey is XDOWEJICGSZQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5/c9-8-12-5-11-7(13-8)6-1-3-10-4-2-6/h1-5H,(H2,9,11,12,13).
What are the key properties of 4-pyridin-4-yl-1,3,5-triazin-2-amine?
4-pyridin-4-yl-1,3,5-triazin-2-amine has a molecular weight of 173.18 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-yl-1,3,5-triazin-2-amine is sourced from PubChem (CID 14977275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).