C20H8F12I2O8 — CID 14977555
[[4-[4-[bis[(2,2,2-trifluoroacetyl)oxy]-lambda3-iodanyl]phenyl]phenyl]-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate (PubChem CID 14977555) has the molecular formula C20H8F12I2O8 and a molecular weight of 858.06 g/mol. Its IUPAC name is [[4-[4-[bis[(2,2,2-trifluoroacetyl)oxy]-lambda3-iodanyl]phenyl]phenyl]-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate.
| Compound Name | [[4-[4-[bis[(2,2,2-trifluoroacetyl)oxy]-lambda3-iodanyl]phenyl]phenyl]-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 14977555 |
| Molecular Formula | C20H8F12I2O8 |
| Molecular Weight | 858.06 g/mol |
| Exact Mass | 857.81 |
| IUPAC Name | [[4-[4-[bis[(2,2,2-trifluoroacetyl)oxy]-lambda3-iodanyl]phenyl]phenyl]-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OI(OC(=O)C(F)(F)F)c1ccc(-c2ccc(I(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H8F12I2O8/c21-17(22,23)13(35)39-33(40-14(36)18(24,25)26)11-5-1-9(2-6-11)10-3-7-12(8-4-10)34(41-15(37)19(27,28)29)42-16(38)20(30,31)32/h1-8H |
| InChIKey | VGDOWFFQYLTOIN-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.06 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|