About 5-ethyl-2,3-dimethylfuran
5-ethyl-2,3-dimethylfuran (PubChem CID 14977581) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 5-ethyl-2,3-dimethylfuran.
Molecular Properties
| Compound Name | 5-ethyl-2,3-dimethylfuran |
| PubChem CID | 14977581 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 5-ethyl-2,3-dimethylfuran |
| SMILES | CCc1cc(C)c(C)o1 |
| InChI | InChI=1S/C8H12O/c1-4-8-5-6(2)7(3)9-8/h5H,4H2,1-3H3 |
| InChIKey | RPDGPLVOCZMLMF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-2,3-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,3-dimethylfuran?
The IUPAC name of 5-ethyl-2,3-dimethylfuran (CID 14977581) is 5-ethyl-2,3-dimethylfuran.
What is the SMILES notation for 5-ethyl-2,3-dimethylfuran?
The canonical SMILES for 5-ethyl-2,3-dimethylfuran is CCc1cc(C)c(C)o1.
What is the InChIKey of 5-ethyl-2,3-dimethylfuran?
The InChIKey is RPDGPLVOCZMLMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-4-8-5-6(2)7(3)9-8/h5H,4H2,1-3H3.
What are the key properties of 5-ethyl-2,3-dimethylfuran?
5-ethyl-2,3-dimethylfuran has a molecular weight of 124.18 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,3-dimethylfuran is sourced from PubChem (CID 14977581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).