About 3-(2-amino-1,3-thiazol-4-yl)phenol
3-(2-amino-1,3-thiazol-4-yl)phenol (PubChem CID 1497786) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-4-yl)phenol.
Molecular Properties
| Compound Name | 3-(2-amino-1,3-thiazol-4-yl)phenol |
| PubChem CID | 1497786 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-4-yl)phenol |
| SMILES | Nc1nc(-c2cccc(O)c2)cs1 |
| InChI | InChI=1S/C9H8N2OS/c10-9-11-8(5-13-9)6-2-1-3-7(12)4-6/h1-5,12H,(H2,10,11) |
| InChIKey | DSTSMWRMFXIWCT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-amino-1,3-thiazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-1,3-thiazol-4-yl)phenol?
The IUPAC name of 3-(2-amino-1,3-thiazol-4-yl)phenol (CID 1497786) is 3-(2-amino-1,3-thiazol-4-yl)phenol.
What is the SMILES notation for 3-(2-amino-1,3-thiazol-4-yl)phenol?
The canonical SMILES for 3-(2-amino-1,3-thiazol-4-yl)phenol is Nc1nc(-c2cccc(O)c2)cs1.
What is the InChIKey of 3-(2-amino-1,3-thiazol-4-yl)phenol?
The InChIKey is DSTSMWRMFXIWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c10-9-11-8(5-13-9)6-2-1-3-7(12)4-6/h1-5,12H,(H2,10,11).
What are the key properties of 3-(2-amino-1,3-thiazol-4-yl)phenol?
3-(2-amino-1,3-thiazol-4-yl)phenol has a molecular weight of 192.24 g/mol, XLogP of 2.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-1,3-thiazol-4-yl)phenol is sourced from PubChem (CID 1497786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).