About N-benzyloxolan-3-amine
N-benzyloxolan-3-amine (PubChem CID 14977996) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is N-benzyloxolan-3-amine.
Molecular Properties
| Compound Name | N-benzyloxolan-3-amine |
| PubChem CID | 14977996 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | N-benzyloxolan-3-amine |
| SMILES | c1ccc(CNC2CCOC2)cc1 |
| InChI | InChI=1S/C11H15NO/c1-2-4-10(5-3-1)8-12-11-6-7-13-9-11/h1-5,11-12H,6-9H2 |
| InChIKey | FBMSAAPBKKNIEI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyloxolan-3-amine?
The IUPAC name of N-benzyloxolan-3-amine (CID 14977996) is N-benzyloxolan-3-amine.
What is the SMILES notation for N-benzyloxolan-3-amine?
The canonical SMILES for N-benzyloxolan-3-amine is c1ccc(CNC2CCOC2)cc1.
What is the InChIKey of N-benzyloxolan-3-amine?
The InChIKey is FBMSAAPBKKNIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-2-4-10(5-3-1)8-12-11-6-7-13-9-11/h1-5,11-12H,6-9H2.
What are the key properties of N-benzyloxolan-3-amine?
N-benzyloxolan-3-amine has a molecular weight of 177.25 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyloxolan-3-amine is sourced from PubChem (CID 14977996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).