C10H10ClNS — CID 14978115
7-chloro-1,3,4,5-tetrahydro-1-benzazepine-2-thione (PubChem CID 14978115) has the molecular formula C10H10ClNS and a molecular weight of 211.72 g/mol. Its IUPAC name is 7-chloro-1,3,4,5-tetrahydro-1-benzazepine-2-thione.
| Compound Name | 7-chloro-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
|---|---|
| PubChem CID | 14978115 |
| Molecular Formula | C10H10ClNS |
| Molecular Weight | 211.72 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 7-chloro-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
| SMILES | S=C1CCCc2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C10H10ClNS/c11-8-4-5-9-7(6-8)2-1-3-10(13)12-9/h4-6H,1-3H2,(H,12,13) |
| InChIKey | JRLAZUZKEVQUMH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|