About 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine
4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine (PubChem CID 14978128) has the molecular formula C9H11NS2
and a molecular weight of 197.33 g/mol. Its IUPAC name is 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine.
Molecular Properties
| Compound Name | 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine |
| PubChem CID | 14978128 |
| Molecular Formula | C9H11NS2 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine |
| SMILES | CSC1=NCCCc2sccc21 |
| InChI | InChI=1S/C9H11NS2/c1-11-9-7-4-6-12-8(7)3-2-5-10-9/h4,6H,2-3,5H2,1H3 |
| InChIKey | AOAUWPSCARBDTM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine?
The IUPAC name of 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine (CID 14978128) is 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine.
What is the SMILES notation for 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine?
The canonical SMILES for 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine is CSC1=NCCCc2sccc21.
What is the InChIKey of 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine?
The InChIKey is AOAUWPSCARBDTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS2/c1-11-9-7-4-6-12-8(7)3-2-5-10-9/h4,6H,2-3,5H2,1H3.
What are the key properties of 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine?
4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine has a molecular weight of 197.33 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-7,8-dihydro-6H-thieno[3,2-c]azepine is sourced from PubChem (CID 14978128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).