About 1-(1H-1,2,4-triazol-5-yl)heptan-1-one
1-(1H-1,2,4-triazol-5-yl)heptan-1-one (PubChem CID 14978343) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)heptan-1-one.
Molecular Properties
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)heptan-1-one |
| PubChem CID | 14978343 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)heptan-1-one |
| SMILES | CCCCCCC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C9H15N3O/c1-2-3-4-5-6-8(13)9-10-7-11-12-9/h7H,2-6H2,1H3,(H,10,11,12) |
| InChIKey | VDGGUJSZVVSAPM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(1H-1,2,4-triazol-5-yl)heptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-1,2,4-triazol-5-yl)heptan-1-one?
The IUPAC name of 1-(1H-1,2,4-triazol-5-yl)heptan-1-one (CID 14978343) is 1-(1H-1,2,4-triazol-5-yl)heptan-1-one.
What is the SMILES notation for 1-(1H-1,2,4-triazol-5-yl)heptan-1-one?
The canonical SMILES for 1-(1H-1,2,4-triazol-5-yl)heptan-1-one is CCCCCCC(=O)c1ncn[nH]1.
What is the InChIKey of 1-(1H-1,2,4-triazol-5-yl)heptan-1-one?
The InChIKey is VDGGUJSZVVSAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-2-3-4-5-6-8(13)9-10-7-11-12-9/h7H,2-6H2,1H3,(H,10,11,12).
What are the key properties of 1-(1H-1,2,4-triazol-5-yl)heptan-1-one?
1-(1H-1,2,4-triazol-5-yl)heptan-1-one has a molecular weight of 181.24 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-1,2,4-triazol-5-yl)heptan-1-one is sourced from PubChem (CID 14978343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).