About 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide
2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide (PubChem CID 14978591) has the molecular formula C14H15N3O3
and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide |
| PubChem CID | 14978591 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide |
| SMILES | CC(=O)NC(C(=O)NCc1ccccc1)c1ncco1 |
| InChI | InChI=1S/C14H15N3O3/c1-10(18)17-12(14-15-7-8-20-14)13(19)16-9-11-5-3-2-4-6-11/h2-8,12H,9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | APNHPHDZRMOLIS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide?
The IUPAC name of 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide (CID 14978591) is 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide.
What is the SMILES notation for 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide?
The canonical SMILES for 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide is CC(=O)NC(C(=O)NCc1ccccc1)c1ncco1.
What is the InChIKey of 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide?
The InChIKey is APNHPHDZRMOLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3/c1-10(18)17-12(14-15-7-8-20-14)13(19)16-9-11-5-3-2-4-6-11/h2-8,12H,9H2,1H3,(H,16,19)(H,17,18).
What are the key properties of 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide?
2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide has a molecular weight of 273.29 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-N-benzyl-2-(1,3-oxazol-2-yl)acetamide is sourced from PubChem (CID 14978591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).