C13H14N4O3 — CID 14978594
2-acetamido-N-benzyl-2-(1,2,4-oxadiazol-3-yl)acetamide (PubChem CID 14978594) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-acetamido-N-benzyl-2-(1,2,4-oxadiazol-3-yl)acetamide.
| Compound Name | 2-acetamido-N-benzyl-2-(1,2,4-oxadiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 14978594 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-acetamido-N-benzyl-2-(1,2,4-oxadiazol-3-yl)acetamide |
| SMILES | CC(=O)NC(C(=O)NCc1ccccc1)c1ncon1 |
| InChI | InChI=1S/C13H14N4O3/c1-9(18)16-11(12-15-8-20-17-12)13(19)14-7-10-5-3-2-4-6-10/h2-6,8,11H,7H2,1H3,(H,14,19)(H,16,18) |
| InChIKey | MBYSLIGCUYLPAW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |