About 4,5-dimethyl-3,4-dihydropyridine
4,5-dimethyl-3,4-dihydropyridine (PubChem CID 14979272) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 4,5-dimethyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 4,5-dimethyl-3,4-dihydropyridine |
| PubChem CID | 14979272 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 4,5-dimethyl-3,4-dihydropyridine |
| SMILES | CC1=CN=CCC1C |
| InChI | InChI=1S/C7H11N/c1-6-3-4-8-5-7(6)2/h4-6H,3H2,1-2H3 |
| InChIKey | PMAABVWJSUIBFV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dimethyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3,4-dihydropyridine?
The IUPAC name of 4,5-dimethyl-3,4-dihydropyridine (CID 14979272) is 4,5-dimethyl-3,4-dihydropyridine.
What is the SMILES notation for 4,5-dimethyl-3,4-dihydropyridine?
The canonical SMILES for 4,5-dimethyl-3,4-dihydropyridine is CC1=CN=CCC1C.
What is the InChIKey of 4,5-dimethyl-3,4-dihydropyridine?
The InChIKey is PMAABVWJSUIBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-6-3-4-8-5-7(6)2/h4-6H,3H2,1-2H3.
What are the key properties of 4,5-dimethyl-3,4-dihydropyridine?
4,5-dimethyl-3,4-dihydropyridine has a molecular weight of 109.17 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3,4-dihydropyridine is sourced from PubChem (CID 14979272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).