C16H30O2Si2 — CID 14979597
2,3-bis[tert-butyl(dimethyl)silyl]buta-1,3-diene-1,4-dione (PubChem CID 14979597) has the molecular formula C16H30O2Si2 and a molecular weight of 310.59 g/mol. Its IUPAC name is 2,3-bis[tert-butyl(dimethyl)silyl]buta-1,3-diene-1,4-dione.
| Compound Name | 2,3-bis[tert-butyl(dimethyl)silyl]buta-1,3-diene-1,4-dione |
|---|---|
| PubChem CID | 14979597 |
| Molecular Formula | C16H30O2Si2 |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2,3-bis[tert-butyl(dimethyl)silyl]buta-1,3-diene-1,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)C(=C=O)C(=C=O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O2Si2/c1-15(2,3)19(7,8)13(11-17)14(12-18)20(9,10)16(4,5)6/h1-10H3 |
| InChIKey | VBUDGMYBOQMVQE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|