About iodozinc(1+);trifluoromethylbenzene
iodozinc(1+);trifluoromethylbenzene (PubChem CID 14980131) has the molecular formula C7H4F3IZn
and a molecular weight of 337.40 g/mol. Its IUPAC name is iodozinc(1+);trifluoromethylbenzene.
Molecular Properties
| Compound Name | iodozinc(1+);trifluoromethylbenzene |
| PubChem CID | 14980131 |
| Molecular Formula | C7H4F3IZn |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 335.86 |
| IUPAC Name | iodozinc(1+);trifluoromethylbenzene |
| SMILES | FC(F)(F)c1[c-]cccc1.[Zn+]I |
| InChI | InChI=1S/C7H4F3.HI.Zn/c8-7(9,10)6-4-2-1-3-5-6;;/h1-4H;1H;/q-1;;+2/p-1 |
| InChIKey | VWZBBBCFZIMSHO-UHFFFAOYSA-M |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodozinc(1+);trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodozinc(1+);trifluoromethylbenzene?
The IUPAC name of iodozinc(1+);trifluoromethylbenzene (CID 14980131) is iodozinc(1+);trifluoromethylbenzene.
What is the SMILES notation for iodozinc(1+);trifluoromethylbenzene?
The canonical SMILES for iodozinc(1+);trifluoromethylbenzene is FC(F)(F)c1[c-]cccc1.[Zn+]I.
What is the InChIKey of iodozinc(1+);trifluoromethylbenzene?
The InChIKey is VWZBBBCFZIMSHO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4F3.HI.Zn/c8-7(9,10)6-4-2-1-3-5-6;;/h1-4H;1H;/q-1;;+2/p-1.
What are the key properties of iodozinc(1+);trifluoromethylbenzene?
iodozinc(1+);trifluoromethylbenzene has a molecular weight of 337.40 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iodozinc(1+);trifluoromethylbenzene is sourced from PubChem (CID 14980131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).