C19H18 — CID 14980237
tetracyclo[6.6.5.02,7.09,14]nonadeca-1,3,5,7,9,11,13-heptaene (PubChem CID 14980237) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is tetracyclo[6.6.5.02,7.09,14]nonadeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | tetracyclo[6.6.5.02,7.09,14]nonadeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 14980237 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | tetracyclo[6.6.5.02,7.09,14]nonadeca-1,3,5,7,9,11,13-heptaene |
| SMILES | c1ccc2c3c4ccccc4c(c2c1)CCCCC3 |
| InChI | InChI=1S/C19H18/c1-2-8-14-16-10-4-6-12-18(16)15(9-3-1)19-13-7-5-11-17(14)19/h4-7,10-13H,1-3,8-9H2 |
| InChIKey | KNVCUHHDTNZJKZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|