C16H17BrN2O4S — CID 1498168
(5E)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 1498168) has the molecular formula C16H17BrN2O4S and a molecular weight of 413.29 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 1498168 |
| Molecular Formula | C16H17BrN2O4S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | (5E)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | COc1cc(OC)c(/C=C2/SC(N3CCOCC3)=NC2=O)cc1Br |
| InChI | InChI=1S/C16H17BrN2O4S/c1-21-12-9-13(22-2)11(17)7-10(12)8-14-15(20)18-16(24-14)19-3-5-23-6-4-19/h7-9H,3-6H2,1-2H3/b14-8+ |
| InChIKey | UXNCAHMBKISMEU-RIYZIHGNSA-N |
| XLogP | 2.77 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|