C10F10O — CID 14982080
1,1,3,4,5,6,7-heptafluoro-3-(trifluoromethyl)inden-2-one (PubChem CID 14982080) has the molecular formula C10F10O and a molecular weight of 326.09 g/mol. Its IUPAC name is 1,1,3,4,5,6,7-heptafluoro-3-(trifluoromethyl)inden-2-one.
| Compound Name | 1,1,3,4,5,6,7-heptafluoro-3-(trifluoromethyl)inden-2-one |
|---|---|
| PubChem CID | 14982080 |
| Molecular Formula | C10F10O |
| Molecular Weight | 326.09 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 1,1,3,4,5,6,7-heptafluoro-3-(trifluoromethyl)inden-2-one |
| SMILES | O=C1C(F)(F)c2c(F)c(F)c(F)c(F)c2C1(F)C(F)(F)F |
| InChI | InChI=1S/C10F10O/c11-3-1-2(4(12)6(14)5(3)13)9(16,17)7(21)8(1,15)10(18,19)20 |
| InChIKey | SGZAVIOILODGPJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.09 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|