C34H37N3O4 — CID 14982981
8-[6-(4-oxo-2-phenylchromen-6-yl)oxyhexyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 14982981) has the molecular formula C34H37N3O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is 8-[6-(4-oxo-2-phenylchromen-6-yl)oxyhexyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[6-(4-oxo-2-phenylchromen-6-yl)oxyhexyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 14982981 |
| Molecular Formula | C34H37N3O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 8-[6-(4-oxo-2-phenylchromen-6-yl)oxyhexyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NCN(c2ccccc2)C12CCN(CCCCCCOc1ccc3oc(-c4ccccc4)cc(=O)c3c1)CC2 |
| InChI | InChI=1S/C34H37N3O4/c38-30-24-32(26-11-5-3-6-12-26)41-31-16-15-28(23-29(30)31)40-22-10-2-1-9-19-36-20-17-34(18-21-36)33(39)35-25-37(34)27-13-7-4-8-14-27/h3-8,11-16,23-24H,1-2,9-10,17-22,25H2,(H,35,39) |
| InChIKey | HJPDDBRFRIQQEK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|