About (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol
(E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol (PubChem CID 14983107) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol.
Molecular Properties
| Compound Name | (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol |
| PubChem CID | 14983107 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol |
| SMILES | CCC1CC=C(/C=C/CCO)OC1 |
| InChI | InChI=1S/C11H18O2/c1-2-10-6-7-11(13-9-10)5-3-4-8-12/h3,5,7,10,12H,2,4,6,8-9H2,1H3/b5-3+ |
| InChIKey | HPKDWPSYXLFVFF-HWKANZROSA-N |
| XLogP | 2.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol?
The IUPAC name of (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol (CID 14983107) is (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol.
What is the SMILES notation for (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol?
The canonical SMILES for (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol is CCC1CC=C(/C=C/CCO)OC1.
What is the InChIKey of (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol?
The InChIKey is HPKDWPSYXLFVFF-HWKANZROSA-N. The full InChI is InChI=1S/C11H18O2/c1-2-10-6-7-11(13-9-10)5-3-4-8-12/h3,5,7,10,12H,2,4,6,8-9H2,1H3/b5-3+.
What are the key properties of (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol?
(E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol has a molecular weight of 182.26 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3-ethyl-3,4-dihydro-2H-pyran-6-yl)but-3-en-1-ol is sourced from PubChem (CID 14983107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).