C6H10N4O — CID 14983719
5-(methoxymethyl)pyrimidine-2,4-diamine (PubChem CID 14983719) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-(methoxymethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(methoxymethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 14983719 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 5-(methoxymethyl)pyrimidine-2,4-diamine |
| SMILES | COCc1cnc(N)nc1N |
| InChI | InChI=1S/C6H10N4O/c1-11-3-4-2-9-6(8)10-5(4)7/h2H,3H2,1H3,(H4,7,8,9,10) |
| InChIKey | MICPTYSZVFPCLL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |