C20H16F6O5 — CID 14984591
[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 14984591) has the molecular formula C20H16F6O5 and a molecular weight of 450.33 g/mol. Its IUPAC name is [(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 14984591 |
| Molecular Formula | C20H16F6O5 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H16F6O5/c1-29-17(19(21,22)23,13-9-5-3-6-10-13)15(27)31-16(28)18(30-2,20(24,25)26)14-11-7-4-8-12-14/h3-12H,1-2H3/t17-,18-/m1/s1 |
| InChIKey | AATFPUCRBIXXID-QZTJIDSGSA-N |
| XLogP | 4.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|