C11H22O — CID 14984841
cis-(3S,5S)-3-ethoxy-1,1,5-trimethylcyclohexane (PubChem CID 14984841) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is cis-(3S,5S)-3-ethoxy-1,1,5-trimethylcyclohexane.
| Compound Name | cis-(3S,5S)-3-ethoxy-1,1,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 14984841 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | cis-(3S,5S)-3-ethoxy-1,1,5-trimethylcyclohexane |
| SMILES | CCO[C@H]1C[C@@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C11H22O/c1-5-12-10-6-9(2)7-11(3,4)8-10/h9-10H,5-8H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | JVBNHJDWWBSWLE-ZJUUUORDSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |