C12H18N2O3S — CID 14986214
5-oxo-6-(1,4,5-trimethylimidazol-2-yl)sulfanylhexanoic acid (PubChem CID 14986214) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 5-oxo-6-(1,4,5-trimethylimidazol-2-yl)sulfanylhexanoic acid.
| Compound Name | 5-oxo-6-(1,4,5-trimethylimidazol-2-yl)sulfanylhexanoic acid |
|---|---|
| PubChem CID | 14986214 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 5-oxo-6-(1,4,5-trimethylimidazol-2-yl)sulfanylhexanoic acid |
| SMILES | Cc1nc(SCC(=O)CCCC(=O)O)n(C)c1C |
| InChI | InChI=1S/C12H18N2O3S/c1-8-9(2)14(3)12(13-8)18-7-10(15)5-4-6-11(16)17/h4-7H2,1-3H3,(H,16,17) |
| InChIKey | ZLQTUAGNJQSJCR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |