C19H18ClN5S — CID 14986630
9-(2-chlorophenyl)-3,7-dimethyl-17-thia-2,4,5,8,14-pentazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,8,11(16)-pentaene (PubChem CID 14986630) has the molecular formula C19H18ClN5S and a molecular weight of 383.91 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-3,7-dimethyl-17-thia-2,4,5,8,14-pentazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,8,11(16)-pentaene.
| Compound Name | 9-(2-chlorophenyl)-3,7-dimethyl-17-thia-2,4,5,8,14-pentazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,8,11(16)-pentaene |
|---|---|
| PubChem CID | 14986630 |
| Molecular Formula | C19H18ClN5S |
| Molecular Weight | 383.91 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 9-(2-chlorophenyl)-3,7-dimethyl-17-thia-2,4,5,8,14-pentazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,8,11(16)-pentaene |
| SMILES | Cc1nnc2n1-c1sc3c(c1C(c1ccccc1Cl)=NC2C)CCNC3 |
| InChI | InChI=1S/C19H18ClN5S/c1-10-18-24-23-11(2)25(18)19-16(13-7-8-21-9-15(13)26-19)17(22-10)12-5-3-4-6-14(12)20/h3-6,10,21H,7-9H2,1-2H3 |
| InChIKey | YZZGMPVDMKVAIZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.91 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |