About methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate
methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate (PubChem CID 14986673) has the molecular formula C19H40O4Si
and a molecular weight of 360.61 g/mol. Its IUPAC name is methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate.
Molecular Properties
| Compound Name | methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate |
| PubChem CID | 14986673 |
| Molecular Formula | C19H40O4Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate |
| SMILES | COC(=O)C(C)(C)CC(CCO)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O4Si/c1-18(2,3)24(7,8)23-14-10-9-11-16(12-13-20)15-19(4,5)17(21)22-6/h16,20H,9-15H2,1-8H3 |
| InChIKey | OWWULHWEGWYIDL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate?
The IUPAC name of methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate (CID 14986673) is methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate.
What is the SMILES notation for methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate?
The canonical SMILES for methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate is COC(=O)C(C)(C)CC(CCO)CCCCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate?
The InChIKey is OWWULHWEGWYIDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O4Si/c1-18(2,3)24(7,8)23-14-10-9-11-16(12-13-20)15-19(4,5)17(21)22-6/h16,20H,9-15H2,1-8H3.
What are the key properties of methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate?
methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate has a molecular weight of 360.61 g/mol, XLogP of 4.77, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[tert-butyl(dimethyl)silyl]oxy-4-(2-hydroxyethyl)-2,2-dimethyloctanoate is sourced from PubChem (CID 14986673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).